C30H37NO7 — CID 59051921
(2S,3R,6S,9R,10S)-3,10-dihydroxy-2,9-dimethyl-1-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]-6-phenylmethoxydodec-11-ene-1,8-dione (PubChem CID 59051921) has the molecular formula C30H37NO7 and a molecular weight of 523.63 g/mol. Its IUPAC name is (2S,3R,6S,9R,10S)-3,10-dihydroxy-2,9-dimethyl-1-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]-6-phenylmethoxydodec-11-ene-1,8-dione.
| Compound Name | (2S,3R,6S,9R,10S)-3,10-dihydroxy-2,9-dimethyl-1-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]-6-phenylmethoxydodec-11-ene-1,8-dione |
|---|---|
| PubChem CID | 59051921 |
| Molecular Formula | C30H37NO7 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | (2S,3R,6S,9R,10S)-3,10-dihydroxy-2,9-dimethyl-1-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]-6-phenylmethoxydodec-11-ene-1,8-dione |
| SMILES | C=C[C@H](O)[C@@H](C)C(=O)C[C@H](CC[C@@H](O)[C@H](C)C(=O)N1C(=O)OC[C@@H]1c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C30H37NO7/c1-4-26(32)20(2)28(34)17-24(37-18-22-11-7-5-8-12-22)15-16-27(33)21(3)29(35)31-25(19-38-30(31)36)23-13-9-6-10-14-23/h4-14,20-21,24-27,32-33H,1,15-19H2,2-3H3/t20-,21+,24+,25-,26+,27-/m1/s1 |
| InChIKey | LNEKRWKGXKJZEP-AVPDIACOSA-N |
| XLogP | 4.21 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|