C20H19N3O4 — CID 59052272
(5S,8S)-1-benzyl-2,4-dioxo-3-phenyl-1,3,7-triazaspiro[4.4]nonane-8-carboxylic acid (PubChem CID 59052272) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is (5S,8S)-1-benzyl-2,4-dioxo-3-phenyl-1,3,7-triazaspiro[4.4]nonane-8-carboxylic acid.
| Compound Name | (5S,8S)-1-benzyl-2,4-dioxo-3-phenyl-1,3,7-triazaspiro[4.4]nonane-8-carboxylic acid |
|---|---|
| PubChem CID | 59052272 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (5S,8S)-1-benzyl-2,4-dioxo-3-phenyl-1,3,7-triazaspiro[4.4]nonane-8-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@]2(CN1)C(=O)N(c1ccccc1)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C20H19N3O4/c24-17(25)16-11-20(13-21-16)18(26)23(15-9-5-2-6-10-15)19(27)22(20)12-14-7-3-1-4-8-14/h1-10,16,21H,11-13H2,(H,24,25)/t16-,20-/m0/s1 |
| InChIKey | RRWXYTCIKVEBKJ-JXFKEZNVSA-N |
| XLogP | 1.84 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|