C22H28N4O3 — CID 59081077
2-(4-phenylphenyl)propan-2-yl (NE)-N-[amino-(3-amino-2-tritiooxypiperidin-1-yl)methylidene]carbamate (PubChem CID 59081077) has the molecular formula C22H28N4O3 and a molecular weight of 398.50 g/mol. Its IUPAC name is 2-(4-phenylphenyl)propan-2-yl (NE)-N-[amino-(3-amino-2-tritiooxypiperidin-1-yl)methylidene]carbamate.
| Compound Name | 2-(4-phenylphenyl)propan-2-yl (NE)-N-[amino-(3-amino-2-tritiooxypiperidin-1-yl)methylidene]carbamate |
|---|---|
| PubChem CID | 59081077 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 2-(4-phenylphenyl)propan-2-yl (NE)-N-[amino-(3-amino-2-tritiooxypiperidin-1-yl)methylidene]carbamate |
| SMILES | [3H]OC1C(N)CCCN1/C(N)=N/C(=O)OC(C)(C)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H28N4O3/c1-22(2,17-12-10-16(11-13-17)15-7-4-3-5-8-15)29-21(28)25-20(24)26-14-6-9-18(23)19(26)27/h3-5,7-8,10-13,18-19,27H,6,9,14,23H2,1-2H3,(H2,24,25,28)/i27T |
| InChIKey | VCXSTFOQUSPIDH-SUSGUTBYSA-N |
| XLogP | 2.78 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|