sodium 4-(3-iodopropanoyloxy)-3,5-dimethylbenzoate

C12H12INaO4 — CID 59089620

IUPACsodium 4-(3-iodopropanoyloxy)-3,5-dimethylbenzoate
SMILESCc1cc(C(=O)[O-])cc(C)c1OC(=O)CCI.[Na+]
InChIInChI=1S/C12H13IO4.Na/c1-7-5-9(12(15)16)6-8(2)11(7)17-10(14)3-4-13;/h5-6H,3-4H2,1-2H3,(H,15,16);/q;+1/p-1
InChIKeyIFVSYKRRDLQBQP-UHFFFAOYSA-M
MW370.12 g/mol
LogP-1.60
Rot. Bonds4

About sodium 4-(3-iodopropanoyloxy)-3,5-dimethylbenzoate

sodium 4-(3-iodopropanoyloxy)-3,5-dimethylbenzoate (PubChem CID 59089620) has the molecular formula C12H12INaO4 and a molecular weight of 370.12 g/mol. Its IUPAC name is sodium 4-(3-iodopropanoyloxy)-3,5-dimethylbenzoate.

Molecular Properties

Compound Namesodium 4-(3-iodopropanoyloxy)-3,5-dimethylbenzoate
PubChem CID59089620
Molecular FormulaC12H12INaO4
Molecular Weight370.12 g/mol
Exact Mass369.97
IUPAC Namesodium 4-(3-iodopropanoyloxy)-3,5-dimethylbenzoate
SMILESCc1cc(C(=O)[O-])cc(C)c1OC(=O)CCI.[Na+]
InChIInChI=1S/C12H13IO4.Na/c1-7-5-9(12(15)16)6-8(2)11(7)17-10(14)3-4-13;/h5-6H,3-4H2,1-2H3,(H,15,16);/q;+1/p-1
InChIKeyIFVSYKRRDLQBQP-UHFFFAOYSA-M
XLogP-1.60
TPSA66.43 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500370.12
LogP ≤ 5-1.60
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze sodium 4-(3-iodopropanoyloxy)-3,5-dimethylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 4-(3-iodopropanoyloxy)-3,5-dimethylbenzoate?
The IUPAC name of sodium 4-(3-iodopropanoyloxy)-3,5-dimethylbenzoate (CID 59089620) is sodium 4-(3-iodopropanoyloxy)-3,5-dimethylbenzoate.
What is the SMILES notation for sodium 4-(3-iodopropanoyloxy)-3,5-dimethylbenzoate?
The canonical SMILES for sodium 4-(3-iodopropanoyloxy)-3,5-dimethylbenzoate is Cc1cc(C(=O)[O-])cc(C)c1OC(=O)CCI.[Na+].
What is the InChIKey of sodium 4-(3-iodopropanoyloxy)-3,5-dimethylbenzoate?
The InChIKey is IFVSYKRRDLQBQP-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H13IO4.Na/c1-7-5-9(12(15)16)6-8(2)11(7)17-10(14)3-4-13;/h5-6H,3-4H2,1-2H3,(H,15,16);/q;+1/p-1.
What are the key properties of sodium 4-(3-iodopropanoyloxy)-3,5-dimethylbenzoate?
sodium 4-(3-iodopropanoyloxy)-3,5-dimethylbenzoate has a molecular weight of 370.12 g/mol, XLogP of -1.60, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-(3-iodopropanoyloxy)-3,5-dimethylbenzoate is sourced from PubChem (CID 59089620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).