C12H12INaO4 — CID 59089620
sodium 4-(3-iodopropanoyloxy)-3,5-dimethylbenzoate (PubChem CID 59089620) has the molecular formula C12H12INaO4 and a molecular weight of 370.12 g/mol. Its IUPAC name is sodium 4-(3-iodopropanoyloxy)-3,5-dimethylbenzoate.
| Compound Name | sodium 4-(3-iodopropanoyloxy)-3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 59089620 |
| Molecular Formula | C12H12INaO4 |
| Molecular Weight | 370.12 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | sodium 4-(3-iodopropanoyloxy)-3,5-dimethylbenzoate |
| SMILES | Cc1cc(C(=O)[O-])cc(C)c1OC(=O)CCI.[Na+] |
| InChI | InChI=1S/C12H13IO4.Na/c1-7-5-9(12(15)16)6-8(2)11(7)17-10(14)3-4-13;/h5-6H,3-4H2,1-2H3,(H,15,16);/q;+1/p-1 |
| InChIKey | IFVSYKRRDLQBQP-UHFFFAOYSA-M |
| XLogP | -1.60 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.12 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|