C24H36N2O8S — CID 59090721
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2R)-1-[cyclopentyloxy-(4-methylphenyl)sulfonylamino]-2-hydroxypentan-3-yl]carbamate (PubChem CID 59090721) has the molecular formula C24H36N2O8S and a molecular weight of 512.63 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2R)-1-[cyclopentyloxy-(4-methylphenyl)sulfonylamino]-2-hydroxypentan-3-yl]carbamate.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2R)-1-[cyclopentyloxy-(4-methylphenyl)sulfonylamino]-2-hydroxypentan-3-yl]carbamate |
|---|---|
| PubChem CID | 59090721 |
| Molecular Formula | C24H36N2O8S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2R)-1-[cyclopentyloxy-(4-methylphenyl)sulfonylamino]-2-hydroxypentan-3-yl]carbamate |
| SMILES | CCC(NC(=O)O[C@H]1CO[C@H]2OCC[C@H]21)[C@H](O)CN(OC1CCCC1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H36N2O8S/c1-3-20(25-24(28)33-22-15-32-23-19(22)12-13-31-23)21(27)14-26(34-17-6-4-5-7-17)35(29,30)18-10-8-16(2)9-11-18/h8-11,17,19-23,27H,3-7,12-15H2,1-2H3,(H,25,28)/t19-,20?,21+,22-,23+/m0/s1 |
| InChIKey | NOPFQSAMETWYEL-VMTQICNPSA-N |
| XLogP | 2.49 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|