C29H43N3O11S — CID 59090772
[(3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2R,3S)-1-[cyclopentyloxy-[3-(2-morpholin-4-yl-2-oxoethoxy)phenyl]sulfonylamino]-2-hydroxypentan-3-yl]carbamate (PubChem CID 59090772) has the molecular formula C29H43N3O11S and a molecular weight of 641.74 g/mol. Its IUPAC name is [(3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2R,3S)-1-[cyclopentyloxy-[3-(2-morpholin-4-yl-2-oxoethoxy)phenyl]sulfonylamino]-2-hydroxypentan-3-yl]carbamate.
| Compound Name | [(3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2R,3S)-1-[cyclopentyloxy-[3-(2-morpholin-4-yl-2-oxoethoxy)phenyl]sulfonylamino]-2-hydroxypentan-3-yl]carbamate |
|---|---|
| PubChem CID | 59090772 |
| Molecular Formula | C29H43N3O11S |
| Molecular Weight | 641.74 g/mol |
| Exact Mass | 641.26 |
| IUPAC Name | [(3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2R,3S)-1-[cyclopentyloxy-[3-(2-morpholin-4-yl-2-oxoethoxy)phenyl]sulfonylamino]-2-hydroxypentan-3-yl]carbamate |
| SMILES | CC[C@H](NC(=O)OC1CO[C@H]2OCC[C@@H]12)[C@H](O)CN(OC1CCCC1)S(=O)(=O)c1cccc(OCC(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C29H43N3O11S/c1-2-24(30-29(35)42-26-18-41-28-23(26)10-13-39-28)25(33)17-32(43-20-6-3-4-7-20)44(36,37)22-9-5-8-21(16-22)40-19-27(34)31-11-14-38-15-12-31/h5,8-9,16,20,23-26,28,33H,2-4,6-7,10-15,17-19H2,1H3,(H,30,35)/t23-,24-,25+,26?,28+/m0/s1 |
| InChIKey | IRHJXWHALZLXOL-XVDKUNPHSA-N |
| XLogP | 1.42 |
| TPSA | 162.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.74 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|