C24H45NSi — CID 59091540
N-[dimethyl(4-tetracyclo[12.4.0.02,6.07,12]octadecanyl)silyl]-2-methylpropan-2-amine (PubChem CID 59091540) has the molecular formula C24H45NSi and a molecular weight of 375.72 g/mol. Its IUPAC name is N-[dimethyl(4-tetracyclo[12.4.0.02,6.07,12]octadecanyl)silyl]-2-methylpropan-2-amine.
| Compound Name | N-[dimethyl(4-tetracyclo[12.4.0.02,6.07,12]octadecanyl)silyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 59091540 |
| Molecular Formula | C24H45NSi |
| Molecular Weight | 375.72 g/mol |
| Exact Mass | 375.33 |
| IUPAC Name | N-[dimethyl(4-tetracyclo[12.4.0.02,6.07,12]octadecanyl)silyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)N[Si](C)(C)C1CC2C3CCCCC3CC3CCCCC3C2C1 |
| InChI | InChI=1S/C24H45NSi/c1-24(2,3)25-26(4,5)19-15-22-20-12-8-6-10-17(20)14-18-11-7-9-13-21(18)23(22)16-19/h17-23,25H,6-16H2,1-5H3 |
| InChIKey | PRWBJKJYNVKHSU-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.72 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|