About 3,4-dichloro-N-[(4-chlorophenyl)sulfanylmethyl]-1,2-thiazole-5-carboxamide
3,4-dichloro-N-[(4-chlorophenyl)sulfanylmethyl]-1,2-thiazole-5-carboxamide (PubChem CID 59098172) has the molecular formula C11H7Cl3N2OS2
and a molecular weight of 353.68 g/mol. Its IUPAC name is 3,4-dichloro-N-[(4-chlorophenyl)sulfanylmethyl]-1,2-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 3,4-dichloro-N-[(4-chlorophenyl)sulfanylmethyl]-1,2-thiazole-5-carboxamide |
| PubChem CID | 59098172 |
| Molecular Formula | C11H7Cl3N2OS2 |
| Molecular Weight | 353.68 g/mol |
| Exact Mass | 351.91 |
| IUPAC Name | 3,4-dichloro-N-[(4-chlorophenyl)sulfanylmethyl]-1,2-thiazole-5-carboxamide |
| SMILES | O=C(NCSc1ccc(Cl)cc1)c1snc(Cl)c1Cl |
| InChI | InChI=1S/C11H7Cl3N2OS2/c12-6-1-3-7(4-2-6)18-5-15-11(17)9-8(13)10(14)16-19-9/h1-4H,5H2,(H,15,17) |
| InChIKey | PQHLMYKFMULVBB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.68 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dichloro-N-[(4-chlorophenyl)sulfanylmethyl]-1,2-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dichloro-N-[(4-chlorophenyl)sulfanylmethyl]-1,2-thiazole-5-carboxamide?
The IUPAC name of 3,4-dichloro-N-[(4-chlorophenyl)sulfanylmethyl]-1,2-thiazole-5-carboxamide (CID 59098172) is 3,4-dichloro-N-[(4-chlorophenyl)sulfanylmethyl]-1,2-thiazole-5-carboxamide.
What is the SMILES notation for 3,4-dichloro-N-[(4-chlorophenyl)sulfanylmethyl]-1,2-thiazole-5-carboxamide?
The canonical SMILES for 3,4-dichloro-N-[(4-chlorophenyl)sulfanylmethyl]-1,2-thiazole-5-carboxamide is O=C(NCSc1ccc(Cl)cc1)c1snc(Cl)c1Cl.
What is the InChIKey of 3,4-dichloro-N-[(4-chlorophenyl)sulfanylmethyl]-1,2-thiazole-5-carboxamide?
The InChIKey is PQHLMYKFMULVBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7Cl3N2OS2/c12-6-1-3-7(4-2-6)18-5-15-11(17)9-8(13)10(14)16-19-9/h1-4H,5H2,(H,15,17).
What are the key properties of 3,4-dichloro-N-[(4-chlorophenyl)sulfanylmethyl]-1,2-thiazole-5-carboxamide?
3,4-dichloro-N-[(4-chlorophenyl)sulfanylmethyl]-1,2-thiazole-5-carboxamide has a molecular weight of 353.68 g/mol, XLogP of 4.58, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dichloro-N-[(4-chlorophenyl)sulfanylmethyl]-1,2-thiazole-5-carboxamide is sourced from PubChem (CID 59098172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).