C11H7Cl3N2OS2 — CID 59098172
3,4-dichloro-N-[(4-chlorophenyl)sulfanylmethyl]-1,2-thiazole-5-carboxamide (PubChem CID 59098172) has the molecular formula C11H7Cl3N2OS2 and a molecular weight of 353.68 g/mol. Its IUPAC name is 3,4-dichloro-N-[(4-chlorophenyl)sulfanylmethyl]-1,2-thiazole-5-carboxamide.
| Compound Name | 3,4-dichloro-N-[(4-chlorophenyl)sulfanylmethyl]-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 59098172 |
| Molecular Formula | C11H7Cl3N2OS2 |
| Molecular Weight | 353.68 g/mol |
| Exact Mass | 351.91 |
| IUPAC Name | 3,4-dichloro-N-[(4-chlorophenyl)sulfanylmethyl]-1,2-thiazole-5-carboxamide |
| SMILES | O=C(NCSc1ccc(Cl)cc1)c1snc(Cl)c1Cl |
| InChI | InChI=1S/C11H7Cl3N2OS2/c12-6-1-3-7(4-2-6)18-5-15-11(17)9-8(13)10(14)16-19-9/h1-4H,5H2,(H,15,17) |
| InChIKey | PQHLMYKFMULVBB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.68 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|