C8H14O2 — CID 59100581
1,1,2,2,3,3,4,4,4-nonadeuteriobutyl 2-(trideuteriomethyl)prop-2-enoate (PubChem CID 59100581) has the molecular formula C8H14O2 and a molecular weight of 154.27 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonadeuteriobutyl 2-(trideuteriomethyl)prop-2-enoate.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonadeuteriobutyl 2-(trideuteriomethyl)prop-2-enoate |
|---|---|
| PubChem CID | 59100581 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 154.27 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonadeuteriobutyl 2-(trideuteriomethyl)prop-2-enoate |
| SMILES | [2H]C([2H])([2H])C(=C)C(=O)OC([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C8H14O2/c1-4-5-6-10-8(9)7(2)3/h2,4-6H2,1,3H3/i1D3,3D3,4D2,5D2,6D2 |
| InChIKey | SOGAXMICEFXMKE-FNIDOOINSA-N |
| XLogP | 1.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|