C34H41N2O10S2+ — CID 59100612
2-[(1Z,3Z,5Z,7Z)-7-[5-(dihydroxymethyl)-3,3-dimethyl-1-(2-sulfoethyl)indol-2-ylidene]-4-methylhepta-1,3,5-trienyl]-3,3-dimethyl-1-(2-sulfoethyl)indol-1-ium-5-carboxylic acid (PubChem CID 59100612) has the molecular formula C34H41N2O10S2+ and a molecular weight of 701.84 g/mol. Its IUPAC name is 2-[(1Z,3Z,5Z,7Z)-7-[5-(dihydroxymethyl)-3,3-dimethyl-1-(2-sulfoethyl)indol-2-ylidene]-4-methylhepta-1,3,5-trienyl]-3,3-dimethyl-1-(2-sulfoethyl)indol-1-ium-5-carboxylic acid.
| Compound Name | 2-[(1Z,3Z,5Z,7Z)-7-[5-(dihydroxymethyl)-3,3-dimethyl-1-(2-sulfoethyl)indol-2-ylidene]-4-methylhepta-1,3,5-trienyl]-3,3-dimethyl-1-(2-sulfoethyl)indol-1-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 59100612 |
| Molecular Formula | C34H41N2O10S2+ |
| Molecular Weight | 701.84 g/mol |
| Exact Mass | 701.22 |
| IUPAC Name | 2-[(1Z,3Z,5Z,7Z)-7-[5-(dihydroxymethyl)-3,3-dimethyl-1-(2-sulfoethyl)indol-2-ylidene]-4-methylhepta-1,3,5-trienyl]-3,3-dimethyl-1-(2-sulfoethyl)indol-1-ium-5-carboxylic acid |
| SMILES | CC(/C=C\C=C1/N(CCS(=O)(=O)O)c2ccc(C(O)O)cc2C1(C)C)=C/C=C\C1=[N+](CCS(=O)(=O)O)c2ccc(C(=O)O)cc2C1(C)C |
| InChI | InChI=1S/C34H40N2O10S2/c1-22(8-6-10-29-33(2,3)25-20-23(31(37)38)12-14-27(25)35(29)16-18-47(41,42)43)9-7-11-30-34(4,5)26-21-24(32(39)40)13-15-28(26)36(30)17-19-48(44,45)46/h6-15,20-21,31,37-38H,16-19H2,1-5H3,(H2-,39,40,41,42,43,44,45,46)/p+1 |
| InChIKey | RLKSZTZBXWPHJW-UHFFFAOYSA-O |
| XLogP | 4.26 |
| TPSA | 192.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.84 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|