About CID 59101409
CID 59101409 (PubChem CID 59101409) has the molecular formula C6H13O2Pb
and a molecular weight of 324.37 g/mol.
Molecular Properties
| Compound Name | CID 59101409 |
| PubChem CID | 59101409 |
| Molecular Formula | C6H13O2Pb |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | — |
| SMILES | CCC(CO)CCO[Pb] |
| InChI | InChI=1S/C6H13O2.Pb/c1-2-6(5-8)3-4-7;/h6,8H,2-5H2,1H3;/q-1;+1 |
| InChIKey | CJPVKCSLYFBXPO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 59101409 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59101409?
The IUPAC name of CID 59101409 (CID 59101409) is not available.
What is the SMILES notation for CID 59101409?
The canonical SMILES for CID 59101409 is CCC(CO)CCO[Pb].
What is the InChIKey of CID 59101409?
The InChIKey is CJPVKCSLYFBXPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13O2.Pb/c1-2-6(5-8)3-4-7;/h6,8H,2-5H2,1H3;/q-1;+1.
What are the key properties of CID 59101409?
CID 59101409 has a molecular weight of 324.37 g/mol, XLogP of 0.50, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59101409 is sourced from PubChem (CID 59101409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).