C19H20N2O4S — CID 59111749
(2R)-1'-(hydroxysulfanylmethyl)-3',3'-dimethyl-6-nitrospiro[7,8-dihydrochromene-2,2'-indole] (PubChem CID 59111749) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is (2R)-1'-(hydroxysulfanylmethyl)-3',3'-dimethyl-6-nitrospiro[7,8-dihydrochromene-2,2'-indole].
| Compound Name | (2R)-1'-(hydroxysulfanylmethyl)-3',3'-dimethyl-6-nitrospiro[7,8-dihydrochromene-2,2'-indole] |
|---|---|
| PubChem CID | 59111749 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (2R)-1'-(hydroxysulfanylmethyl)-3',3'-dimethyl-6-nitrospiro[7,8-dihydrochromene-2,2'-indole] |
| SMILES | CC1(C)c2ccccc2N(CSO)[C@@]12C=CC1=C(CCC([N+](=O)[O-])=C1)O2 |
| InChI | InChI=1S/C19H20N2O4S/c1-18(2)15-5-3-4-6-16(15)20(12-26-24)19(18)10-9-13-11-14(21(22)23)7-8-17(13)25-19/h3-6,9-11,24H,7-8,12H2,1-2H3/t19-/m1/s1 |
| InChIKey | TZIGGNXFVXYMNC-LJQANCHMSA-N |
| XLogP | 4.44 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|