C19H30N2O6S — CID 59111881
benzyl N-[2-[(2R)-3-hydroxy-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]sulfanylethyl]carbamate (PubChem CID 59111881) has the molecular formula C19H30N2O6S and a molecular weight of 414.52 g/mol. Its IUPAC name is benzyl N-[2-[(2R)-3-hydroxy-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]sulfanylethyl]carbamate.
| Compound Name | benzyl N-[2-[(2R)-3-hydroxy-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 59111881 |
| Molecular Formula | C19H30N2O6S |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | benzyl N-[2-[(2R)-3-hydroxy-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]sulfanylethyl]carbamate |
| SMILES | COC(O)[C@H](CSCCNC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H30N2O6S/c1-19(2,3)27-18(24)21-15(16(22)25-4)13-28-11-10-20-17(23)26-12-14-8-6-5-7-9-14/h5-9,15-16,22H,10-13H2,1-4H3,(H,20,23)(H,21,24)/t15-,16?/m0/s1 |
| InChIKey | JHWNNQXAKLTCRQ-VYRBHSGPSA-N |
| XLogP | 2.50 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|