About 8-methyl-6-thia-10-azatricyclo[7.4.0.02,7]tridec-3-ene
8-methyl-6-thia-10-azatricyclo[7.4.0.02,7]tridec-3-ene (PubChem CID 59121128) has the molecular formula C12H19NS
and a molecular weight of 209.36 g/mol. Its IUPAC name is 8-methyl-6-thia-10-azatricyclo[7.4.0.02,7]tridec-3-ene.
Molecular Properties
| Compound Name | 8-methyl-6-thia-10-azatricyclo[7.4.0.02,7]tridec-3-ene |
| PubChem CID | 59121128 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 8-methyl-6-thia-10-azatricyclo[7.4.0.02,7]tridec-3-ene |
| SMILES | CC1C2NCCCC2C2C=CCSC12 |
| InChI | InChI=1S/C12H19NS/c1-8-11-9(4-2-6-13-11)10-5-3-7-14-12(8)10/h3,5,8-13H,2,4,6-7H2,1H3 |
| InChIKey | UVUALBSFPJPJSI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-6-thia-10-azatricyclo[7.4.0.02,7]tridec-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-6-thia-10-azatricyclo[7.4.0.02,7]tridec-3-ene?
The IUPAC name of 8-methyl-6-thia-10-azatricyclo[7.4.0.02,7]tridec-3-ene (CID 59121128) is 8-methyl-6-thia-10-azatricyclo[7.4.0.02,7]tridec-3-ene.
What is the SMILES notation for 8-methyl-6-thia-10-azatricyclo[7.4.0.02,7]tridec-3-ene?
The canonical SMILES for 8-methyl-6-thia-10-azatricyclo[7.4.0.02,7]tridec-3-ene is CC1C2NCCCC2C2C=CCSC12.
What is the InChIKey of 8-methyl-6-thia-10-azatricyclo[7.4.0.02,7]tridec-3-ene?
The InChIKey is UVUALBSFPJPJSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NS/c1-8-11-9(4-2-6-13-11)10-5-3-7-14-12(8)10/h3,5,8-13H,2,4,6-7H2,1H3.
What are the key properties of 8-methyl-6-thia-10-azatricyclo[7.4.0.02,7]tridec-3-ene?
8-methyl-6-thia-10-azatricyclo[7.4.0.02,7]tridec-3-ene has a molecular weight of 209.36 g/mol, XLogP of 2.29, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-6-thia-10-azatricyclo[7.4.0.02,7]tridec-3-ene is sourced from PubChem (CID 59121128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).