C6H13NO — CID 59130953
(3S,5S)-1-methanidyl-5-methylpyrrolidin-1-ium-3-ol (PubChem CID 59130953) has the molecular formula C6H13NO and a molecular weight of 115.18 g/mol. Its IUPAC name is (3S,5S)-1-methanidyl-5-methylpyrrolidin-1-ium-3-ol.
| Compound Name | (3S,5S)-1-methanidyl-5-methylpyrrolidin-1-ium-3-ol |
|---|---|
| PubChem CID | 59130953 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | (3S,5S)-1-methanidyl-5-methylpyrrolidin-1-ium-3-ol |
| SMILES | [CH2-][NH+]1C[C@@H](O)C[C@@H]1C |
| InChI | InChI=1S/C6H13NO/c1-5-3-6(8)4-7(5)2/h5-8H,2-4H2,1H3/t5-,6-/m0/s1 |
| InChIKey | LSMISZPIQGHLLU-WDSKDSINSA-N |
| XLogP | -1.18 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|