C28H30N2O12S3 — CID 59141748
2-[2,7-dimethyl-3-(3-sulfanyloxyperoxypropylimino)-6-(3-sulfopropylamino)xanthen-9-yl]-3-sulfobenzoic acid (PubChem CID 59141748) has the molecular formula C28H30N2O12S3 and a molecular weight of 682.75 g/mol. Its IUPAC name is 2-[2,7-dimethyl-3-(3-sulfanyloxyperoxypropylimino)-6-(3-sulfopropylamino)xanthen-9-yl]-3-sulfobenzoic acid.
| Compound Name | 2-[2,7-dimethyl-3-(3-sulfanyloxyperoxypropylimino)-6-(3-sulfopropylamino)xanthen-9-yl]-3-sulfobenzoic acid |
|---|---|
| PubChem CID | 59141748 |
| Molecular Formula | C28H30N2O12S3 |
| Molecular Weight | 682.75 g/mol |
| Exact Mass | 682.10 |
| IUPAC Name | 2-[2,7-dimethyl-3-(3-sulfanyloxyperoxypropylimino)-6-(3-sulfopropylamino)xanthen-9-yl]-3-sulfobenzoic acid |
| SMILES | Cc1cc2c(-c3c(C(=O)O)cccc3S(=O)(=O)O)c3cc(C)/c(=N/CCCOOOS)cc-3oc2cc1NCCCS(=O)(=O)O |
| InChI | InChI=1S/C28H30N2O12S3/c1-16-12-19-23(14-21(16)29-8-4-10-39-41-42-43)40-24-15-22(30-9-5-11-44(33,34)35)17(2)13-20(24)26(19)27-18(28(31)32)6-3-7-25(27)45(36,37)38/h3,6-7,12-15,30,43H,4-5,8-11H2,1-2H3,(H,31,32)(H,33,34,35)(H,36,37,38)/b29-21+ |
| InChIKey | CEJCWYHJAMRRIJ-XHLNEMQHSA-N |
| XLogP | 4.47 |
| TPSA | 211.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.75 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|