C26H20F6N2O3 — CID 173371322
2-[2,7-dimethyl-3-(1,1,2-trifluoroethylamino)-6-(1,1,2-trifluoroethylimino)xanthen-9-yl]benzoic acid (PubChem CID 173371322) has the molecular formula C26H20F6N2O3 and a molecular weight of 522.45 g/mol. Its IUPAC name is 2-[2,7-dimethyl-3-(1,1,2-trifluoroethylamino)-6-(1,1,2-trifluoroethylimino)xanthen-9-yl]benzoic acid.
| Compound Name | 2-[2,7-dimethyl-3-(1,1,2-trifluoroethylamino)-6-(1,1,2-trifluoroethylimino)xanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 173371322 |
| Molecular Formula | C26H20F6N2O3 |
| Molecular Weight | 522.45 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | 2-[2,7-dimethyl-3-(1,1,2-trifluoroethylamino)-6-(1,1,2-trifluoroethylimino)xanthen-9-yl]benzoic acid |
| SMILES | Cc1cc2c(-c3ccccc3C(=O)O)c3cc(C)c(=NC(F)(F)CF)cc-3oc2cc1NC(F)(F)CF |
| InChI | InChI=1S/C26H20F6N2O3/c1-13-7-17-21(9-19(13)33-25(29,30)11-27)37-22-10-20(34-26(31,32)12-28)14(2)8-18(22)23(17)15-5-3-4-6-16(15)24(35)36/h3-10,33H,11-12H2,1-2H3,(H,35,36) |
| InChIKey | NUGFPBVGDVDPNL-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.45 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|