C26H22F6N2O4 — CID 173371323
[9-(2-carboxyphenyl)-2,7-dimethyl-6-(1,2,2-trifluoroethylamino)xanthen-3-ylidene]-(1,2,2-trifluoroethyl)azanium hydroxide (PubChem CID 173371323) has the molecular formula C26H22F6N2O4 and a molecular weight of 540.46 g/mol. Its IUPAC name is [9-(2-carboxyphenyl)-2,7-dimethyl-6-(1,2,2-trifluoroethylamino)xanthen-3-ylidene]-(1,2,2-trifluoroethyl)azanium hydroxide.
| Compound Name | [9-(2-carboxyphenyl)-2,7-dimethyl-6-(1,2,2-trifluoroethylamino)xanthen-3-ylidene]-(1,2,2-trifluoroethyl)azanium hydroxide |
|---|---|
| PubChem CID | 173371323 |
| Molecular Formula | C26H22F6N2O4 |
| Molecular Weight | 540.46 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | [9-(2-carboxyphenyl)-2,7-dimethyl-6-(1,2,2-trifluoroethylamino)xanthen-3-ylidene]-(1,2,2-trifluoroethyl)azanium hydroxide |
| SMILES | Cc1cc2c(-c3ccccc3C(=O)O)c3cc(C)c(=[NH+]C(F)C(F)F)cc-3oc2cc1NC(F)C(F)F.[OH-] |
| InChI | InChI=1S/C26H20F6N2O3.H2O/c1-11-7-15-19(9-17(11)33-24(31)22(27)28)37-20-10-18(34-25(32)23(29)30)12(2)8-16(20)21(15)13-5-3-4-6-14(13)26(35)36;/h3-10,22-25,33H,1-2H3,(H,35,36);1H2 |
| InChIKey | WRJPSDBVTDCPJS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|