C36H35N2O5+ — CID 144685036
cyclobut-2-en-1-yl-[6-(cyclobut-2-en-1-ylamino)-2,7-dimethyl-9-[2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]phenyl]xanthen-3-ylidene]azanium (PubChem CID 144685036) has the molecular formula C36H35N2O5+ and a molecular weight of 575.69 g/mol. Its IUPAC name is cyclobut-2-en-1-yl-[6-(cyclobut-2-en-1-ylamino)-2,7-dimethyl-9-[2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]phenyl]xanthen-3-ylidene]azanium.
| Compound Name | cyclobut-2-en-1-yl-[6-(cyclobut-2-en-1-ylamino)-2,7-dimethyl-9-[2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]phenyl]xanthen-3-ylidene]azanium |
|---|---|
| PubChem CID | 144685036 |
| Molecular Formula | C36H35N2O5+ |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | cyclobut-2-en-1-yl-[6-(cyclobut-2-en-1-ylamino)-2,7-dimethyl-9-[2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]phenyl]xanthen-3-ylidene]azanium |
| SMILES | C=C(C)C(=O)OCCOC(=O)c1ccccc1-c1c2cc(C)/c(=[NH+]/C3C=CC3)cc-2oc2cc(NC3C=CC3)c(C)cc12 |
| InChI | InChI=1S/C36H34N2O5/c1-21(2)35(39)41-15-16-42-36(40)27-14-6-5-13-26(27)34-28-17-22(3)30(37-24-9-7-10-24)19-32(28)43-33-20-31(23(4)18-29(33)34)38-25-11-8-12-25/h5-9,11,13-14,17-20,24-25,37H,1,10,12,15-16H2,2-4H3/p+1/b38-31+ |
| InChIKey | CRQKLLCFAPEJQM-KPITYXSVSA-O |
| XLogP | 5.15 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|