About CID 59161494
CID 59161494 (PubChem CID 59161494) has the molecular formula C3H6BN
and a molecular weight of 66.90 g/mol.
Molecular Properties
| Compound Name | CID 59161494 |
| PubChem CID | 59161494 |
| Molecular Formula | C3H6BN |
| Molecular Weight | 66.90 g/mol |
| Exact Mass | 67.06 |
| IUPAC Name | — |
| SMILES | [B][C@H]1C[C@H]1N |
| InChI | InChI=1S/C3H6BN/c4-2-1-3(2)5/h2-3H,1,5H2/t2-,3+/m0/s1 |
| InChIKey | UMCJVXQLICFFJE-STHAYSLISA-N |
| XLogP | -0.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 66.90 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59161494 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59161494?
The IUPAC name of CID 59161494 (CID 59161494) is not available.
What is the SMILES notation for CID 59161494?
The canonical SMILES for CID 59161494 is [B][C@H]1C[C@H]1N.
What is the InChIKey of CID 59161494?
The InChIKey is UMCJVXQLICFFJE-STHAYSLISA-N. The full InChI is InChI=1S/C3H6BN/c4-2-1-3(2)5/h2-3H,1,5H2/t2-,3+/m0/s1.
What are the key properties of CID 59161494?
CID 59161494 has a molecular weight of 66.90 g/mol, XLogP of -0.33, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59161494 is sourced from PubChem (CID 59161494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).