C16H30N2O2 — CID 59163724
(2S)-2-(methylamino)-N-[(E,3S)-2-methyl-6-oxohept-4-en-3-yl]heptanamide (PubChem CID 59163724) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is (2S)-2-(methylamino)-N-[(E,3S)-2-methyl-6-oxohept-4-en-3-yl]heptanamide.
| Compound Name | (2S)-2-(methylamino)-N-[(E,3S)-2-methyl-6-oxohept-4-en-3-yl]heptanamide |
|---|---|
| PubChem CID | 59163724 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | (2S)-2-(methylamino)-N-[(E,3S)-2-methyl-6-oxohept-4-en-3-yl]heptanamide |
| SMILES | CCCCC[C@H](NC)C(=O)N[C@H](/C=C/C(C)=O)C(C)C |
| InChI | InChI=1S/C16H30N2O2/c1-6-7-8-9-15(17-5)16(20)18-14(12(2)3)11-10-13(4)19/h10-12,14-15,17H,6-9H2,1-5H3,(H,18,20)/b11-10+/t14-,15+/m1/s1 |
| InChIKey | PWMBYFKTYWDRLQ-UNNWNWIUSA-N |
| XLogP | 2.44 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|