C9H8IN2+ — CID 59176944
3-iodo-7-methyl-2-methylideneimidazo[1,2-a]pyridin-4-ium (PubChem CID 59176944) has the molecular formula C9H8IN2+ and a molecular weight of 271.08 g/mol. Its IUPAC name is 3-iodo-7-methyl-2-methylideneimidazo[1,2-a]pyridin-4-ium.
| Compound Name | 3-iodo-7-methyl-2-methylideneimidazo[1,2-a]pyridin-4-ium |
|---|---|
| PubChem CID | 59176944 |
| Molecular Formula | C9H8IN2+ |
| Molecular Weight | 271.08 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | 3-iodo-7-methyl-2-methylideneimidazo[1,2-a]pyridin-4-ium |
| SMILES | C=C1N=c2cc(C)cc[n+]2=C1I |
| InChI | InChI=1S/C9H8IN2/c1-6-3-4-12-8(5-6)11-7(2)9(12)10/h3-5H,2H2,1H3/q+1 |
| InChIKey | RXGQCHDXGCIUHL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 18.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.08 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|