C30H44O8 — CID 59189171
bis(cyclohexyloxymethyl) 1-(2-methylprop-2-enoyloxy)tricyclo[4.3.1.03,8]decane-4,6-dicarboxylate (PubChem CID 59189171) has the molecular formula C30H44O8 and a molecular weight of 532.67 g/mol. Its IUPAC name is bis(cyclohexyloxymethyl) 1-(2-methylprop-2-enoyloxy)tricyclo[4.3.1.03,8]decane-4,6-dicarboxylate.
| Compound Name | bis(cyclohexyloxymethyl) 1-(2-methylprop-2-enoyloxy)tricyclo[4.3.1.03,8]decane-4,6-dicarboxylate |
|---|---|
| PubChem CID | 59189171 |
| Molecular Formula | C30H44O8 |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | bis(cyclohexyloxymethyl) 1-(2-methylprop-2-enoyloxy)tricyclo[4.3.1.03,8]decane-4,6-dicarboxylate |
| SMILES | C=C(C)C(=O)OC12CC3CC(C(=O)OCOC4CCCCC4)(CC(C(=O)OCOC4CCCCC4)C3C1)C2 |
| InChI | InChI=1S/C30H44O8/c1-20(2)26(31)38-30-14-21-13-29(17-30,28(33)37-19-35-23-11-7-4-8-12-23)15-25(24(21)16-30)27(32)36-18-34-22-9-5-3-6-10-22/h21-25H,1,3-19H2,2H3 |
| InChIKey | VPJUPBKVEZDJNK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|