C13H15N5O3S — CID 59208396
2-[6-(ethylcarbamoylamino)-3-pyridinyl]-N-methoxy-1,3-thiazole-5-carboxamide (PubChem CID 59208396) has the molecular formula C13H15N5O3S and a molecular weight of 321.36 g/mol. Its IUPAC name is 2-[6-(ethylcarbamoylamino)-3-pyridinyl]-N-methoxy-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[6-(ethylcarbamoylamino)-3-pyridinyl]-N-methoxy-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 59208396 |
| Molecular Formula | C13H15N5O3S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2-[6-(ethylcarbamoylamino)-3-pyridinyl]-N-methoxy-1,3-thiazole-5-carboxamide |
| SMILES | CCNC(=O)Nc1ccc(-c2ncc(C(=O)NOC)s2)cn1 |
| InChI | InChI=1S/C13H15N5O3S/c1-3-14-13(20)17-10-5-4-8(6-15-10)12-16-7-9(22-12)11(19)18-21-2/h4-7H,3H2,1-2H3,(H,18,19)(H2,14,15,17,20) |
| InChIKey | ZNRDDZHGFXWRCS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|