C17H16N4O4S — CID 169151312
methyl 2-[2-[[2-(4-aminophenyl)-1,3-thiazole-5-carbonyl]amino]prop-2-enoylamino]prop-2-enoate (PubChem CID 169151312) has the molecular formula C17H16N4O4S and a molecular weight of 372.41 g/mol. Its IUPAC name is methyl 2-[2-[[2-(4-aminophenyl)-1,3-thiazole-5-carbonyl]amino]prop-2-enoylamino]prop-2-enoate.
| Compound Name | methyl 2-[2-[[2-(4-aminophenyl)-1,3-thiazole-5-carbonyl]amino]prop-2-enoylamino]prop-2-enoate |
|---|---|
| PubChem CID | 169151312 |
| Molecular Formula | C17H16N4O4S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | methyl 2-[2-[[2-(4-aminophenyl)-1,3-thiazole-5-carbonyl]amino]prop-2-enoylamino]prop-2-enoate |
| SMILES | C=C(NC(=O)c1cnc(-c2ccc(N)cc2)s1)C(=O)NC(=C)C(=O)OC |
| InChI | InChI=1S/C17H16N4O4S/c1-9(14(22)21-10(2)17(24)25-3)20-15(23)13-8-19-16(26-13)11-4-6-12(18)7-5-11/h4-8H,1-2,18H2,3H3,(H,20,23)(H,21,22) |
| InChIKey | QWFNJIVHJFPHDY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|