C44H50O9 — CID 59228666
2-[4-[2-[4-[1-[4-(2-prop-2-enoyloxyethoxy)phenyl]-1-(3-prop-2-enoyloxy-1-oxaspiro[3.5]nonan-7-yl)ethyl]phenyl]propan-2-yl]phenoxy]ethyl prop-2-enoate (PubChem CID 59228666) has the molecular formula C44H50O9 and a molecular weight of 722.87 g/mol. Its IUPAC name is 2-[4-[2-[4-[1-[4-(2-prop-2-enoyloxyethoxy)phenyl]-1-(3-prop-2-enoyloxy-1-oxaspiro[3.5]nonan-7-yl)ethyl]phenyl]propan-2-yl]phenoxy]ethyl prop-2-enoate.
| Compound Name | 2-[4-[2-[4-[1-[4-(2-prop-2-enoyloxyethoxy)phenyl]-1-(3-prop-2-enoyloxy-1-oxaspiro[3.5]nonan-7-yl)ethyl]phenyl]propan-2-yl]phenoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 59228666 |
| Molecular Formula | C44H50O9 |
| Molecular Weight | 722.87 g/mol |
| Exact Mass | 722.35 |
| IUPAC Name | 2-[4-[2-[4-[1-[4-(2-prop-2-enoyloxyethoxy)phenyl]-1-(3-prop-2-enoyloxy-1-oxaspiro[3.5]nonan-7-yl)ethyl]phenyl]propan-2-yl]phenoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1ccc(C(C)(C)c2ccc(C(C)(c3ccc(OCCOC(=O)C=C)cc3)C3CCC4(CC3)OCC4OC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C44H50O9/c1-7-39(45)50-28-26-48-36-18-14-32(15-19-36)42(4,5)31-10-12-33(13-11-31)43(6,34-16-20-37(21-17-34)49-27-29-51-40(46)8-2)35-22-24-44(25-23-35)38(30-52-44)53-41(47)9-3/h7-21,35,38H,1-3,22-30H2,4-6H3 |
| InChIKey | GMQWWXFSKIHCGR-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.87 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|