C23H19F9O — CID 59246970
2-[3-[3,5-difluoro-4-(3,3,3-trifluoroprop-1-ynyl)phenyl]-1,1-difluoropropoxy]-1,3-difluoro-5-pentylbenzene (PubChem CID 59246970) has the molecular formula C23H19F9O and a molecular weight of 482.39 g/mol. Its IUPAC name is 2-[3-[3,5-difluoro-4-(3,3,3-trifluoroprop-1-ynyl)phenyl]-1,1-difluoropropoxy]-1,3-difluoro-5-pentylbenzene.
| Compound Name | 2-[3-[3,5-difluoro-4-(3,3,3-trifluoroprop-1-ynyl)phenyl]-1,1-difluoropropoxy]-1,3-difluoro-5-pentylbenzene |
|---|---|
| PubChem CID | 59246970 |
| Molecular Formula | C23H19F9O |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 2-[3-[3,5-difluoro-4-(3,3,3-trifluoroprop-1-ynyl)phenyl]-1,1-difluoropropoxy]-1,3-difluoro-5-pentylbenzene |
| SMILES | CCCCCc1cc(F)c(OC(F)(F)CCc2cc(F)c(C#CC(F)(F)F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C23H19F9O/c1-2-3-4-5-14-12-19(26)21(20(27)13-14)33-23(31,32)9-6-15-10-17(24)16(18(25)11-15)7-8-22(28,29)30/h10-13H,2-6,9H2,1H3 |
| InChIKey | NATDGHJEQDXQJP-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|