C20H13F7 — CID 59247195
2-[(E)-2-[3,5-difluoro-4-(3,3,3-trifluoroprop-1-ynyl)phenyl]ethenyl]-1,3-difluoro-5-propylbenzene (PubChem CID 59247195) has the molecular formula C20H13F7 and a molecular weight of 386.31 g/mol. Its IUPAC name is 2-[(E)-2-[3,5-difluoro-4-(3,3,3-trifluoroprop-1-ynyl)phenyl]ethenyl]-1,3-difluoro-5-propylbenzene.
| Compound Name | 2-[(E)-2-[3,5-difluoro-4-(3,3,3-trifluoroprop-1-ynyl)phenyl]ethenyl]-1,3-difluoro-5-propylbenzene |
|---|---|
| PubChem CID | 59247195 |
| Molecular Formula | C20H13F7 |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 2-[(E)-2-[3,5-difluoro-4-(3,3,3-trifluoroprop-1-ynyl)phenyl]ethenyl]-1,3-difluoro-5-propylbenzene |
| SMILES | CCCc1cc(F)c(/C=C/c2cc(F)c(C#CC(F)(F)F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C20H13F7/c1-2-3-12-8-16(21)14(17(22)9-12)5-4-13-10-18(23)15(19(24)11-13)6-7-20(25,26)27/h4-5,8-11H,2-3H2,1H3/b5-4+ |
| InChIKey | LBBAWNHDQNMZLC-SNAWJCMRSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|