C11H17NO3S2 — CID 59255563
5-methyl-N-[(2S,3S)-3-methyl-1-oxopentan-2-yl]thiophene-2-sulfonamide (PubChem CID 59255563) has the molecular formula C11H17NO3S2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 5-methyl-N-[(2S,3S)-3-methyl-1-oxopentan-2-yl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[(2S,3S)-3-methyl-1-oxopentan-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 59255563 |
| Molecular Formula | C11H17NO3S2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 5-methyl-N-[(2S,3S)-3-methyl-1-oxopentan-2-yl]thiophene-2-sulfonamide |
| SMILES | CC[C@H](C)[C@@H](C=O)NS(=O)(=O)c1ccc(C)s1 |
| InChI | InChI=1S/C11H17NO3S2/c1-4-8(2)10(7-13)12-17(14,15)11-6-5-9(3)16-11/h5-8,10,12H,4H2,1-3H3/t8-,10+/m0/s1 |
| InChIKey | JETXILVFLPUOPQ-WCBMZHEXSA-N |
| XLogP | 1.95 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|