C26H22Cl3N3O — CID 59261764
(2R)-2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(4S)-7-isocyano-3,4-dihydro-2H-chromen-4-yl]piperazine (PubChem CID 59261764) has the molecular formula C26H22Cl3N3O and a molecular weight of 498.84 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(4S)-7-isocyano-3,4-dihydro-2H-chromen-4-yl]piperazine.
| Compound Name | (2R)-2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(4S)-7-isocyano-3,4-dihydro-2H-chromen-4-yl]piperazine |
|---|---|
| PubChem CID | 59261764 |
| Molecular Formula | C26H22Cl3N3O |
| Molecular Weight | 498.84 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(4S)-7-isocyano-3,4-dihydro-2H-chromen-4-yl]piperazine |
| SMILES | [C-]#[N+]c1ccc2c(c1)OCC[C@@H]2N1CCN(c2ccc(Cl)cc2Cl)[C@H](c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C26H22Cl3N3O/c1-30-20-7-8-21-23(10-13-33-26(21)15-20)31-11-12-32(24-9-6-19(28)14-22(24)29)25(16-31)17-2-4-18(27)5-3-17/h2-9,14-15,23,25H,10-13,16H2/t23-,25-/m0/s1 |
| InChIKey | JCIVWTCYGPTTJV-ZCYQVOJMSA-N |
| XLogP | 7.58 |
| TPSA | 20.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.84 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|