C32H51O3- — CID 59271386
(5E,10E)-13-(8a-butyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-2,6,10-trimethyltrideca-5,10-dienoate (PubChem CID 59271386) has the molecular formula C32H51O3- and a molecular weight of 483.76 g/mol. Its IUPAC name is (5E,10E)-13-(8a-butyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-2,6,10-trimethyltrideca-5,10-dienoate.
| Compound Name | (5E,10E)-13-(8a-butyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-2,6,10-trimethyltrideca-5,10-dienoate |
|---|---|
| PubChem CID | 59271386 |
| Molecular Formula | C32H51O3- |
| Molecular Weight | 483.76 g/mol |
| Exact Mass | 483.38 |
| IUPAC Name | (5E,10E)-13-(8a-butyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-2,6,10-trimethyltrideca-5,10-dienoate |
| SMILES | CCCCC12OC(C)(CC/C=C(\C)CCC/C(C)=C/CCC(C)C(=O)[O-])CCC1=CC=C(C)C2C |
| InChI | InChI=1S/C32H52O3/c1-8-9-22-32-28(6)26(4)18-19-29(32)20-23-31(7,35-32)21-12-16-25(3)14-10-13-24(2)15-11-17-27(5)30(33)34/h15-16,18-19,27-28H,8-14,17,20-23H2,1-7H3,(H,33,34)/p-1/b24-15+,25-16+ |
| InChIKey | RHPAJVMLJFYKLW-FEZYOMQXSA-M |
| XLogP | 8.02 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.76 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|