C34H55O3- — CID 59271534
(5E,9E)-13-(8a-hexyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-2,6,10-trimethyltrideca-5,9-dienoate (PubChem CID 59271534) has the molecular formula C34H55O3- and a molecular weight of 511.81 g/mol. Its IUPAC name is (5E,9E)-13-(8a-hexyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-2,6,10-trimethyltrideca-5,9-dienoate.
| Compound Name | (5E,9E)-13-(8a-hexyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-2,6,10-trimethyltrideca-5,9-dienoate |
|---|---|
| PubChem CID | 59271534 |
| Molecular Formula | C34H55O3- |
| Molecular Weight | 511.81 g/mol |
| Exact Mass | 511.42 |
| IUPAC Name | (5E,9E)-13-(8a-hexyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-2,6,10-trimethyltrideca-5,9-dienoate |
| SMILES | CCCCCCC12OC(C)(CCC/C(C)=C/CC/C(C)=C/CCC(C)C(=O)[O-])CCC1=CC=C(C)C2C |
| InChI | InChI=1S/C34H56O3/c1-8-9-10-11-24-34-30(6)28(4)20-21-31(34)22-25-33(7,37-34)23-14-18-27(3)16-12-15-26(2)17-13-19-29(5)32(35)36/h16-17,20-21,29-30H,8-15,18-19,22-25H2,1-7H3,(H,35,36)/p-1/b26-17+,27-16+ |
| InChIKey | OOSYMQGIBOUSOV-GJNCCAKSSA-M |
| XLogP | 8.80 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.81 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|