C29H55NO5SSi2 — CID 59280291
4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-6-oxohexan-2-yl]-N-propan-2-ylbenzenesulfonamide (PubChem CID 59280291) has the molecular formula C29H55NO5SSi2 and a molecular weight of 586.00 g/mol. Its IUPAC name is 4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-6-oxohexan-2-yl]-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-6-oxohexan-2-yl]-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 59280291 |
| Molecular Formula | C29H55NO5SSi2 |
| Molecular Weight | 586.00 g/mol |
| Exact Mass | 585.33 |
| IUPAC Name | 4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-6-oxohexan-2-yl]-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)N([C@@H](CCCC=O)CO[Si](C)(C)C(C)(C)C)S(=O)(=O)c1ccc([C@@H](C)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H55NO5SSi2/c1-23(2)30(26(16-14-15-21-31)22-34-37(10,11)28(4,5)6)36(32,33)27-19-17-25(18-20-27)24(3)35-38(12,13)29(7,8)9/h17-21,23-24,26H,14-16,22H2,1-13H3/t24-,26+/m1/s1 |
| InChIKey | MTCAJEQXKBNOBE-RSXGOPAZSA-N |
| XLogP | 7.93 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.00 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|