C23H14IrN2O2-2 — CID 59302094
iridium;10H-isochromeno[4,3-b]pyridin-10-id-6-one;2-phenylpyridine (PubChem CID 59302094) has the molecular formula C23H14IrN2O2-2 and a molecular weight of 542.59 g/mol. Its IUPAC name is iridium;10H-isochromeno[4,3-b]pyridin-10-id-6-one;2-phenylpyridine.
| Compound Name | iridium;10H-isochromeno[4,3-b]pyridin-10-id-6-one;2-phenylpyridine |
|---|---|
| PubChem CID | 59302094 |
| Molecular Formula | C23H14IrN2O2-2 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 543.07 |
| IUPAC Name | iridium;10H-isochromeno[4,3-b]pyridin-10-id-6-one;2-phenylpyridine |
| SMILES | O=c1oc2cccnc2c2[c-]cccc12.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C12H6NO2.C11H8N.Ir/c14-12-9-5-2-1-4-8(9)11-10(15-12)6-3-7-13-11;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-3,5-7H;1-6,8-9H;/q2*-1; |
| InChIKey | ZKCBRRRURBHXSO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|