C23H30FN3O4S2 — CID 59322794
propan-2-yl 4-[2-[(3S)-1-(2-fluoro-4-methylperoxysulfanylphenyl)pyrrolidin-3-yl]-1,3-thiazol-4-yl]piperidine-1-carboxylate (PubChem CID 59322794) has the molecular formula C23H30FN3O4S2 and a molecular weight of 495.64 g/mol. Its IUPAC name is propan-2-yl 4-[2-[(3S)-1-(2-fluoro-4-methylperoxysulfanylphenyl)pyrrolidin-3-yl]-1,3-thiazol-4-yl]piperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[2-[(3S)-1-(2-fluoro-4-methylperoxysulfanylphenyl)pyrrolidin-3-yl]-1,3-thiazol-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59322794 |
| Molecular Formula | C23H30FN3O4S2 |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | propan-2-yl 4-[2-[(3S)-1-(2-fluoro-4-methylperoxysulfanylphenyl)pyrrolidin-3-yl]-1,3-thiazol-4-yl]piperidine-1-carboxylate |
| SMILES | COOSc1ccc(N2CC[C@H](c3nc(C4CCN(C(=O)OC(C)C)CC4)cs3)C2)c(F)c1 |
| InChI | InChI=1S/C23H30FN3O4S2/c1-15(2)30-23(28)26-9-6-16(7-10-26)20-14-32-22(25-20)17-8-11-27(13-17)21-5-4-18(12-19(21)24)33-31-29-3/h4-5,12,14-17H,6-11,13H2,1-3H3/t17-/m0/s1 |
| InChIKey | CWDLFWMUCWEKTN-KRWDZBQOSA-N |
| XLogP | 5.59 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|