C21H22N2O4S2 — CID 59332756
3-(2,2-dimethyl-1,1-dioxothian-4-yl)-5-(5-formylthiophen-3-yl)-1H-indole-7-carboxamide (PubChem CID 59332756) has the molecular formula C21H22N2O4S2 and a molecular weight of 430.55 g/mol. Its IUPAC name is 3-(2,2-dimethyl-1,1-dioxothian-4-yl)-5-(5-formylthiophen-3-yl)-1H-indole-7-carboxamide.
| Compound Name | 3-(2,2-dimethyl-1,1-dioxothian-4-yl)-5-(5-formylthiophen-3-yl)-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 59332756 |
| Molecular Formula | C21H22N2O4S2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 3-(2,2-dimethyl-1,1-dioxothian-4-yl)-5-(5-formylthiophen-3-yl)-1H-indole-7-carboxamide |
| SMILES | CC1(C)CC(c2c[nH]c3c(C(N)=O)cc(-c4csc(C=O)c4)cc23)CCS1(=O)=O |
| InChI | InChI=1S/C21H22N2O4S2/c1-21(2)8-12(3-4-29(21,26)27)18-9-23-19-16(18)6-13(7-17(19)20(22)25)14-5-15(10-24)28-11-14/h5-7,9-12,23H,3-4,8H2,1-2H3,(H2,22,25) |
| InChIKey | PZCZKJLZVYIHSB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|