C22H25FO4 — CID 59337282
5-[2-(4-fluorophenyl)-2-adamantyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 59337282) has the molecular formula C22H25FO4 and a molecular weight of 372.44 g/mol. Its IUPAC name is 5-[2-(4-fluorophenyl)-2-adamantyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[2-(4-fluorophenyl)-2-adamantyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 59337282 |
| Molecular Formula | C22H25FO4 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 5-[2-(4-fluorophenyl)-2-adamantyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(C2(c3ccc(F)cc3)C3CC4CC(C3)CC2C4)C(=O)O1 |
| InChI | InChI=1S/C22H25FO4/c1-21(2)26-19(24)18(20(25)27-21)22(14-3-5-17(23)6-4-14)15-8-12-7-13(10-15)11-16(22)9-12/h3-6,12-13,15-16,18H,7-11H2,1-2H3 |
| InChIKey | YHUMWNCZDOEPMM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|