C23H47N3O6Si — CID 59343128
(2R,3S,4R,5R,6S)-5-azido-6-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-4-[(3R)-3-methoxydecoxy]oxan-3-ol (PubChem CID 59343128) has the molecular formula C23H47N3O6Si and a molecular weight of 489.73 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-5-azido-6-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-4-[(3R)-3-methoxydecoxy]oxan-3-ol.
| Compound Name | (2R,3S,4R,5R,6S)-5-azido-6-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-4-[(3R)-3-methoxydecoxy]oxan-3-ol |
|---|---|
| PubChem CID | 59343128 |
| Molecular Formula | C23H47N3O6Si |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.32 |
| IUPAC Name | (2R,3S,4R,5R,6S)-5-azido-6-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-4-[(3R)-3-methoxydecoxy]oxan-3-ol |
| SMILES | CCCCCCC[C@H](CCO[C@H]1[C@H](O)[C@@H](CO)O[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1N=[N+]=[N-])OC |
| InChI | InChI=1S/C23H47N3O6Si/c1-8-9-10-11-12-13-17(29-5)14-15-30-21-19(25-26-24)22(31-18(16-27)20(21)28)32-33(6,7)23(2,3)4/h17-22,27-28H,8-16H2,1-7H3/t17-,18-,19-,20-,21-,22+/m1/s1 |
| InChIKey | AMLNSKOMSPBBPR-ILHTXMRTSA-N |
| XLogP | 4.92 |
| TPSA | 126.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|