C31H38O6Si — CID 59348783
triethoxy-[4-[(E)-2-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]ethenyl]phenyl]silane (PubChem CID 59348783) has the molecular formula C31H38O6Si and a molecular weight of 534.73 g/mol. Its IUPAC name is triethoxy-[4-[(E)-2-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]ethenyl]phenyl]silane.
| Compound Name | triethoxy-[4-[(E)-2-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]ethenyl]phenyl]silane |
|---|---|
| PubChem CID | 59348783 |
| Molecular Formula | C31H38O6Si |
| Molecular Weight | 534.73 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | triethoxy-[4-[(E)-2-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]ethenyl]phenyl]silane |
| SMILES | CCO[Si](OCC)(OCC)c1ccc(/C=C/c2ccc(/C=C/c3cc(OC)c(OC)c(OC)c3)cc2)cc1 |
| InChI | InChI=1S/C31H38O6Si/c1-7-35-38(36-8-2,37-9-3)28-20-18-26(19-21-28)15-14-24-10-12-25(13-11-24)16-17-27-22-29(32-4)31(34-6)30(23-27)33-5/h10-23H,7-9H2,1-6H3/b15-14+,17-16+ |
| InChIKey | VWWJVCPUKLHYGJ-JLXBFWJWSA-N |
| XLogP | 6.31 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.73 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|