C11H16F2NO4S- — CID 59349878
1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2,2-difluoro-2-oxidoperoxysulfanylethanone (PubChem CID 59349878) has the molecular formula C11H16F2NO4S- and a molecular weight of 296.32 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2,2-difluoro-2-oxidoperoxysulfanylethanone.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2,2-difluoro-2-oxidoperoxysulfanylethanone |
|---|---|
| PubChem CID | 59349878 |
| Molecular Formula | C11H16F2NO4S- |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2,2-difluoro-2-oxidoperoxysulfanylethanone |
| SMILES | O=C(N1CCCC2CCCCC21)C(F)(F)SOO[O-] |
| InChI | InChI=1S/C11H17F2NO4S/c12-11(13,19-18-17-16)10(15)14-7-3-5-8-4-1-2-6-9(8)14/h8-9,16H,1-7H2/p-1 |
| InChIKey | QLMFGXQWEGJWBK-UHFFFAOYSA-M |
| XLogP | 1.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|