C23H29FN2O5 — CID 59355232
tert-butyl 5-fluoro-4-oxo-3-[2-(1-oxoisoquinolin-2-yl)pentanoylamino]pentanoate (PubChem CID 59355232) has the molecular formula C23H29FN2O5 and a molecular weight of 432.49 g/mol. Its IUPAC name is tert-butyl 5-fluoro-4-oxo-3-[2-(1-oxoisoquinolin-2-yl)pentanoylamino]pentanoate.
| Compound Name | tert-butyl 5-fluoro-4-oxo-3-[2-(1-oxoisoquinolin-2-yl)pentanoylamino]pentanoate |
|---|---|
| PubChem CID | 59355232 |
| Molecular Formula | C23H29FN2O5 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | tert-butyl 5-fluoro-4-oxo-3-[2-(1-oxoisoquinolin-2-yl)pentanoylamino]pentanoate |
| SMILES | CCCC(C(=O)NC(CC(=O)OC(C)(C)C)C(=O)CF)n1ccc2ccccc2c1=O |
| InChI | InChI=1S/C23H29FN2O5/c1-5-8-18(26-12-11-15-9-6-7-10-16(15)22(26)30)21(29)25-17(19(27)14-24)13-20(28)31-23(2,3)4/h6-7,9-12,17-18H,5,8,13-14H2,1-4H3,(H,25,29) |
| InChIKey | ISYPORSIMNTVEK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |