C23H30FN2O5+ — CID 90705299
tert-butyl 5-fluoro-4-oxo-3-[[(2S)-2-(1-oxo-4H-isoquinolin-2-ium-2-yl)pentanoyl]amino]pentanoate (PubChem CID 90705299) has the molecular formula C23H30FN2O5+ and a molecular weight of 433.50 g/mol. Its IUPAC name is tert-butyl 5-fluoro-4-oxo-3-[[(2S)-2-(1-oxo-4H-isoquinolin-2-ium-2-yl)pentanoyl]amino]pentanoate.
| Compound Name | tert-butyl 5-fluoro-4-oxo-3-[[(2S)-2-(1-oxo-4H-isoquinolin-2-ium-2-yl)pentanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 90705299 |
| Molecular Formula | C23H30FN2O5+ |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | tert-butyl 5-fluoro-4-oxo-3-[[(2S)-2-(1-oxo-4H-isoquinolin-2-ium-2-yl)pentanoyl]amino]pentanoate |
| SMILES | CCC[C@@H](C(=O)NC(CC(=O)OC(C)(C)C)C(=O)CF)[N+]1=CCc2ccccc2C1=O |
| InChI | InChI=1S/C23H29FN2O5/c1-5-8-18(26-12-11-15-9-6-7-10-16(15)22(26)30)21(29)25-17(19(27)14-24)13-20(28)31-23(2,3)4/h6-7,9-10,12,17-18H,5,8,11,13-14H2,1-4H3/p+1/t17?,18-/m0/s1 |
| InChIKey | VREMXOHFLNPCNJ-ZVAWYAOSSA-O |
| XLogP | 2.39 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|