C17H18N2O5S2 — CID 59356792
O-ethyl 7-(furan-2-ylsulfonylamino)-1-(methoxymethyl)indole-2-carbothioate (PubChem CID 59356792) has the molecular formula C17H18N2O5S2 and a molecular weight of 394.47 g/mol. Its IUPAC name is O-ethyl 7-(furan-2-ylsulfonylamino)-1-(methoxymethyl)indole-2-carbothioate.
| Compound Name | O-ethyl 7-(furan-2-ylsulfonylamino)-1-(methoxymethyl)indole-2-carbothioate |
|---|---|
| PubChem CID | 59356792 |
| Molecular Formula | C17H18N2O5S2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | O-ethyl 7-(furan-2-ylsulfonylamino)-1-(methoxymethyl)indole-2-carbothioate |
| SMILES | CCOC(=S)c1cc2cccc(NS(=O)(=O)c3ccco3)c2n1COC |
| InChI | InChI=1S/C17H18N2O5S2/c1-3-23-17(25)14-10-12-6-4-7-13(16(12)19(14)11-22-2)18-26(20,21)15-8-5-9-24-15/h4-10,18H,3,11H2,1-2H3 |
| InChIKey | QAAGXWHBIPLEFY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|