C30H30BNO4S2 — CID 59357001
CID 59357001 (PubChem CID 59357001) has the molecular formula C30H30BNO4S2 and a molecular weight of 543.52 g/mol.
| Compound Name | CID 59357001 |
|---|---|
| PubChem CID | 59357001 |
| Molecular Formula | C30H30BNO4S2 |
| Molecular Weight | 543.52 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N[C@@H](Cc1ccccc1)C(=O)OCCCCCCOc1ccc(-c2ccc(-c3cccs3)s2)cc1 |
| InChI | InChI=1S/C30H30BNO4S2/c31-30(34)32-25(21-22-9-4-3-5-10-22)29(33)36-19-7-2-1-6-18-35-24-14-12-23(13-15-24)26-16-17-28(38-26)27-11-8-20-37-27/h3-5,8-17,20,25H,1-2,6-7,18-19,21H2,(H,32,34)/t25-/m0/s1 |
| InChIKey | JZYCPMUPDPAGOB-VWLOTQADSA-N |
| XLogP | 7.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.52 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|