C29H36N4O5 — CID 59365196
4-[4-[4-[(4-ethoxy-1-ethylindole-2-carbonyl)amino]phenyl]piperazin-1-yl]-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 59365196) has the molecular formula C29H36N4O5 and a molecular weight of 520.63 g/mol. Its IUPAC name is 4-[4-[4-[(4-ethoxy-1-ethylindole-2-carbonyl)amino]phenyl]piperazin-1-yl]-2,2-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-[4-[4-[(4-ethoxy-1-ethylindole-2-carbonyl)amino]phenyl]piperazin-1-yl]-2,2-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59365196 |
| Molecular Formula | C29H36N4O5 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | 4-[4-[4-[(4-ethoxy-1-ethylindole-2-carbonyl)amino]phenyl]piperazin-1-yl]-2,2-dimethyl-4-oxobutanoic acid |
| SMILES | CCOc1cccc2c1cc(C(=O)Nc1ccc(N3CCN(C(=O)CC(C)(C)C(=O)O)CC3)cc1)n2CC |
| InChI | InChI=1S/C29H36N4O5/c1-5-33-23-8-7-9-25(38-6-2)22(23)18-24(33)27(35)30-20-10-12-21(13-11-20)31-14-16-32(17-15-31)26(34)19-29(3,4)28(36)37/h7-13,18H,5-6,14-17,19H2,1-4H3,(H,30,35)(H,36,37) |
| InChIKey | VWDKHVJGVJNNAQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|