C28H26Cl2N4O3 — CID 66772013
4-[4-[4-[(4,5-dichloro-1-ethylindole-2-carbonyl)amino]phenyl]piperazin-1-yl]benzoic acid (PubChem CID 66772013) has the molecular formula C28H26Cl2N4O3 and a molecular weight of 537.45 g/mol. Its IUPAC name is 4-[4-[4-[(4,5-dichloro-1-ethylindole-2-carbonyl)amino]phenyl]piperazin-1-yl]benzoic acid.
| Compound Name | 4-[4-[4-[(4,5-dichloro-1-ethylindole-2-carbonyl)amino]phenyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 66772013 |
| Molecular Formula | C28H26Cl2N4O3 |
| Molecular Weight | 537.45 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | 4-[4-[4-[(4,5-dichloro-1-ethylindole-2-carbonyl)amino]phenyl]piperazin-1-yl]benzoic acid |
| SMILES | CCn1c(C(=O)Nc2ccc(N3CCN(c4ccc(C(=O)O)cc4)CC3)cc2)cc2c(Cl)c(Cl)ccc21 |
| InChI | InChI=1S/C28H26Cl2N4O3/c1-2-34-24-12-11-23(29)26(30)22(24)17-25(34)27(35)31-19-5-9-21(10-6-19)33-15-13-32(14-16-33)20-7-3-18(4-8-20)28(36)37/h3-12,17H,2,13-16H2,1H3,(H,31,35)(H,36,37) |
| InChIKey | MZHNUMPOJFPOHJ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.45 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|