C31H37Cl3N4O4 — CID 66775715
2-cyclohexyl-4-[4-[4-[(4,5-dichloro-1-ethylindole-2-carbonyl)amino]phenyl]piperazin-1-yl]-4-oxobutanoic acid;hydrochloride (PubChem CID 66775715) has the molecular formula C31H37Cl3N4O4 and a molecular weight of 636.02 g/mol. Its IUPAC name is 2-cyclohexyl-4-[4-[4-[(4,5-dichloro-1-ethylindole-2-carbonyl)amino]phenyl]piperazin-1-yl]-4-oxobutanoic acid;hydrochloride.
| Compound Name | 2-cyclohexyl-4-[4-[4-[(4,5-dichloro-1-ethylindole-2-carbonyl)amino]phenyl]piperazin-1-yl]-4-oxobutanoic acid;hydrochloride |
|---|---|
| PubChem CID | 66775715 |
| Molecular Formula | C31H37Cl3N4O4 |
| Molecular Weight | 636.02 g/mol |
| Exact Mass | 634.19 |
| IUPAC Name | 2-cyclohexyl-4-[4-[4-[(4,5-dichloro-1-ethylindole-2-carbonyl)amino]phenyl]piperazin-1-yl]-4-oxobutanoic acid;hydrochloride |
| SMILES | CCn1c(C(=O)Nc2ccc(N3CCN(C(=O)CC(C(=O)O)C4CCCCC4)CC3)cc2)cc2c(Cl)c(Cl)ccc21.Cl |
| InChI | InChI=1S/C31H36Cl2N4O4.ClH/c1-2-37-26-13-12-25(32)29(33)24(26)18-27(37)30(39)34-21-8-10-22(11-9-21)35-14-16-36(17-15-35)28(38)19-23(31(40)41)20-6-4-3-5-7-20;/h8-13,18,20,23H,2-7,14-17,19H2,1H3,(H,34,39)(H,40,41);1H |
| InChIKey | UNLCTBZYSBWXFV-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.02 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|