C38H44N4O5 — CID 66772407
benzyl 4-[4-[4-[(4-ethoxy-1-ethylindole-2-carbonyl)amino]phenyl]piperazine-1-carbonyl]cyclohexane-1-carboxylate (PubChem CID 66772407) has the molecular formula C38H44N4O5 and a molecular weight of 636.79 g/mol. Its IUPAC name is benzyl 4-[4-[4-[(4-ethoxy-1-ethylindole-2-carbonyl)amino]phenyl]piperazine-1-carbonyl]cyclohexane-1-carboxylate.
| Compound Name | benzyl 4-[4-[4-[(4-ethoxy-1-ethylindole-2-carbonyl)amino]phenyl]piperazine-1-carbonyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 66772407 |
| Molecular Formula | C38H44N4O5 |
| Molecular Weight | 636.79 g/mol |
| Exact Mass | 636.33 |
| IUPAC Name | benzyl 4-[4-[4-[(4-ethoxy-1-ethylindole-2-carbonyl)amino]phenyl]piperazine-1-carbonyl]cyclohexane-1-carboxylate |
| SMILES | CCOc1cccc2c1cc(C(=O)Nc1ccc(N3CCN(C(=O)C4CCC(C(=O)OCc5ccccc5)CC4)CC3)cc1)n2CC |
| InChI | InChI=1S/C38H44N4O5/c1-3-42-33-11-8-12-35(46-4-2)32(33)25-34(42)36(43)39-30-17-19-31(20-18-30)40-21-23-41(24-22-40)37(44)28-13-15-29(16-14-28)38(45)47-26-27-9-6-5-7-10-27/h5-12,17-20,25,28-29H,3-4,13-16,21-24,26H2,1-2H3,(H,39,43) |
| InChIKey | ZSPDAKBKCORLCD-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.79 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|