C18H17BrN3O2Y- — CID 59369377
7-(3-bromopropoxy)-4-(2-methanidylanilino)quinazolin-6-ol;yttrium (PubChem CID 59369377) has the molecular formula C18H17BrN3O2Y- and a molecular weight of 476.16 g/mol. Its IUPAC name is 7-(3-bromopropoxy)-4-(2-methanidylanilino)quinazolin-6-ol;yttrium.
| Compound Name | 7-(3-bromopropoxy)-4-(2-methanidylanilino)quinazolin-6-ol;yttrium |
|---|---|
| PubChem CID | 59369377 |
| Molecular Formula | C18H17BrN3O2Y- |
| Molecular Weight | 476.16 g/mol |
| Exact Mass | 474.96 |
| IUPAC Name | 7-(3-bromopropoxy)-4-(2-methanidylanilino)quinazolin-6-ol;yttrium |
| SMILES | [CH2-]c1ccccc1Nc1ncnc2cc(OCCCBr)c(O)cc12.[Y] |
| InChI | InChI=1S/C18H17BrN3O2.Y/c1-12-5-2-3-6-14(12)22-18-13-9-16(23)17(24-8-4-7-19)10-15(13)20-11-21-18;/h2-3,5-6,9-11,23H,1,4,7-8H2,(H,20,21,22);/q-1; |
| InChIKey | NUUKIBLXYFDUKL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.16 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|