C9H5O4Y-3 — CID 59378860
2-methylbenzene-5-ide-1,4-dicarboxylate;yttrium (PubChem CID 59378860) has the molecular formula C9H5O4Y-3 and a molecular weight of 266.04 g/mol. Its IUPAC name is 2-methylbenzene-5-ide-1,4-dicarboxylate;yttrium.
| Compound Name | 2-methylbenzene-5-ide-1,4-dicarboxylate;yttrium |
|---|---|
| PubChem CID | 59378860 |
| Molecular Formula | C9H5O4Y-3 |
| Molecular Weight | 266.04 g/mol |
| Exact Mass | 265.93 |
| IUPAC Name | 2-methylbenzene-5-ide-1,4-dicarboxylate;yttrium |
| SMILES | Cc1cc(C(=O)[O-])[c-]cc1C(=O)[O-].[Y] |
| InChI | InChI=1S/C9H7O4.Y/c1-5-4-6(8(10)11)2-3-7(5)9(12)13;/h3-4H,1H3,(H,10,11)(H,12,13);/q-1;/p-2 |
| InChIKey | IAWKNSAMUOLMJL-UHFFFAOYSA-L |
| XLogP | -1.48 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.04 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|